C34H52 — CID 91436840
3,20-ditert-butyl-2,2,21,21-tetramethyldocosa-3,5,7,9,11,13,15,17,19-nonaene (PubChem CID 91436840) has the molecular formula C34H52 and a molecular weight of 460.79 g/mol. Its IUPAC name is 3,20-ditert-butyl-2,2,21,21-tetramethyldocosa-3,5,7,9,11,13,15,17,19-nonaene.
| Compound Name | 3,20-ditert-butyl-2,2,21,21-tetramethyldocosa-3,5,7,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 91436840 |
| Molecular Formula | C34H52 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.41 |
| IUPAC Name | 3,20-ditert-butyl-2,2,21,21-tetramethyldocosa-3,5,7,9,11,13,15,17,19-nonaene |
| SMILES | CC(C)(C)C(=CC=CC=CC=CC=CC=CC=CC=CC=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H52/c1-31(2,3)29(32(4,5)6)27-25-23-21-19-17-15-13-14-16-18-20-22-24-26-28-30(33(7,8)9)34(10,11)12/h13-28H,1-12H3 |
| InChIKey | NXTLQUJIAJGMBI-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|