C37H42BBrN2 — CID 91436955
(3-bromo-2,4,6-trimethylphenyl)-[3-(2,3-dihydropyridin-5-yl)-2,4,6-trimethylphenyl]-(2,4,6-trimethyl-3-pyridin-3-ylcyclohexa-2,4-dien-1-yl)borane (PubChem CID 91436955) has the molecular formula C37H42BBrN2 and a molecular weight of 605.47 g/mol. Its IUPAC name is (3-bromo-2,4,6-trimethylphenyl)-[3-(2,3-dihydropyridin-5-yl)-2,4,6-trimethylphenyl]-(2,4,6-trimethyl-3-pyridin-3-ylcyclohexa-2,4-dien-1-yl)borane.
| Compound Name | (3-bromo-2,4,6-trimethylphenyl)-[3-(2,3-dihydropyridin-5-yl)-2,4,6-trimethylphenyl]-(2,4,6-trimethyl-3-pyridin-3-ylcyclohexa-2,4-dien-1-yl)borane |
|---|---|
| PubChem CID | 91436955 |
| Molecular Formula | C37H42BBrN2 |
| Molecular Weight | 605.47 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | (3-bromo-2,4,6-trimethylphenyl)-[3-(2,3-dihydropyridin-5-yl)-2,4,6-trimethylphenyl]-(2,4,6-trimethyl-3-pyridin-3-ylcyclohexa-2,4-dien-1-yl)borane |
| SMILES | CC1=CC(C)C(B(c2c(C)cc(C)c(Br)c2C)c2c(C)cc(C)c(C3=CCCN=C3)c2C)C(C)=C1c1cccnc1 |
| InChI | InChI=1S/C37H42BBrN2/c1-21-16-23(3)34(27(7)32(21)30-12-10-14-40-19-30)38(36-25(5)18-26(6)37(39)29(36)9)35-24(4)17-22(2)33(28(35)8)31-13-11-15-41-20-31/h10,12-14,16-20,23,34H,11,15H2,1-9H3 |
| InChIKey | LSXYEKFVCKJYIS-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.47 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|