C16H16BrClFN5O2 — CID 91437037
4-bromo-2-chloro-6-[1-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]ethyl]phenol (PubChem CID 91437037) has the molecular formula C16H16BrClFN5O2 and a molecular weight of 444.69 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-[1-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]ethyl]phenol.
| Compound Name | 4-bromo-2-chloro-6-[1-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]ethyl]phenol |
|---|---|
| PubChem CID | 91437037 |
| Molecular Formula | C16H16BrClFN5O2 |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 4-bromo-2-chloro-6-[1-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]ethyl]phenol |
| SMILES | CC(/N=N/c1ncc(F)c(N2CCOCC2)n1)c1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C16H16BrClFN5O2/c1-9(11-6-10(17)7-12(18)14(11)25)22-23-16-20-8-13(19)15(21-16)24-2-4-26-5-3-24/h6-9,25H,2-5H2,1H3/b23-22+ |
| InChIKey | RLUPINUZUCSHFJ-GHVJWSGMSA-N |
| XLogP | 4.42 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|