C19H32BrCl2N2O10P — CID 91437178
2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-ol;methyl 3,4-diacetyloxy-6-bromo-5-methyloxane-2-carboxylate (PubChem CID 91437178) has the molecular formula C19H32BrCl2N2O10P and a molecular weight of 630.25 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-ol;methyl 3,4-diacetyloxy-6-bromo-5-methyloxane-2-carboxylate.
| Compound Name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-ol;methyl 3,4-diacetyloxy-6-bromo-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 91437178 |
| Molecular Formula | C19H32BrCl2N2O10P |
| Molecular Weight | 630.25 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-ol;methyl 3,4-diacetyloxy-6-bromo-5-methyloxane-2-carboxylate |
| SMILES | COC(=O)C1OC(Br)C(C)C(OC(C)=O)C1OC(C)=O.O=P1(N(CCCl)CCCl)NC(O)CCO1 |
| InChI | InChI=1S/C12H17BrO7.C7H15Cl2N2O3P/c1-5-8(18-6(2)14)9(19-7(3)15)10(12(16)17-4)20-11(5)13;8-2-4-11(5-3-9)15(13)10-7(12)1-6-14-15/h5,8-11H,1-4H3;7,12H,1-6H2,(H,10,13) |
| InChIKey | PJFFYKQYQYAEPH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|