About 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine
6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine (PubChem CID 91437750) has the molecular formula C17H23ClN4S
and a molecular weight of 350.92 g/mol. Its IUPAC name is 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine |
| PubChem CID | 91437750 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine |
| SMILES | Cc1cc(CN2CCC(CNc3ccc(Cl)nn3)CC2)sc1C |
| InChI | InChI=1S/C17H23ClN4S/c1-12-9-15(23-13(12)2)11-22-7-5-14(6-8-22)10-19-17-4-3-16(18)20-21-17/h3-4,9,14H,5-8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | WORKMCYNXGQMLG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine?
The IUPAC name of 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine (CID 91437750) is 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine.
What is the SMILES notation for 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine?
The canonical SMILES for 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine is Cc1cc(CN2CCC(CNc3ccc(Cl)nn3)CC2)sc1C.
What is the InChIKey of 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine?
The InChIKey is WORKMCYNXGQMLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN4S/c1-12-9-15(23-13(12)2)11-22-7-5-14(6-8-22)10-19-17-4-3-16(18)20-21-17/h3-4,9,14H,5-8,10-11H2,1-2H3,(H,19,21).
What are the key properties of 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine?
6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine has a molecular weight of 350.92 g/mol, XLogP of 4.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[[1-[(4,5-dimethylthiophen-2-yl)methyl]piperidin-4-yl]methyl]pyridazin-3-amine is sourced from PubChem (CID 91437750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).