C15H24N2 — CID 91437982
ethane;2-methyl-3-pentylimidazo[1,2-a]pyridine (PubChem CID 91437982) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;2-methyl-3-pentylimidazo[1,2-a]pyridine.
| Compound Name | ethane;2-methyl-3-pentylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 91437982 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | ethane;2-methyl-3-pentylimidazo[1,2-a]pyridine |
| SMILES | CC.CCCCCc1c(C)nc2ccccn12 |
| InChI | InChI=1S/C13H18N2.C2H6/c1-3-4-5-8-12-11(2)14-13-9-6-7-10-15(12)13;1-2/h6-7,9-10H,3-5,8H2,1-2H3;1-2H3 |
| InChIKey | DSBKJGMDKVNBPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|