C10H16O2 — CID 91438188
2,6-dimethoxy-1,4-dimethylcyclohexa-1,3-diene (PubChem CID 91438188) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,6-dimethoxy-1,4-dimethylcyclohexa-1,3-diene.
| Compound Name | 2,6-dimethoxy-1,4-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91438188 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2,6-dimethoxy-1,4-dimethylcyclohexa-1,3-diene |
| SMILES | COC1=C(C)C(OC)CC(C)=C1 |
| InChI | InChI=1S/C10H16O2/c1-7-5-9(11-3)8(2)10(6-7)12-4/h5,10H,6H2,1-4H3 |
| InChIKey | AXAYBGLJHUGMFJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |