About 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol
2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol (PubChem CID 91438460) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol.
Molecular Properties
| Compound Name | 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol |
| PubChem CID | 91438460 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol |
| SMILES | Cn1c(O)c2c(c1O)CC=C2 |
| InChI | InChI=1S/C8H9NO2/c1-9-7(10)5-3-2-4-6(5)8(9)11/h2-3,10-11H,4H2,1H3 |
| InChIKey | JRGWSSZBILDOBI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol?
The IUPAC name of 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol (CID 91438460) is 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol.
What is the SMILES notation for 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol?
The canonical SMILES for 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol is Cn1c(O)c2c(c1O)CC=C2.
What is the InChIKey of 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol?
The InChIKey is JRGWSSZBILDOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-9-7(10)5-3-2-4-6(5)8(9)11/h2-3,10-11H,4H2,1H3.
What are the key properties of 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol?
2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol has a molecular weight of 151.16 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6H-cyclopenta[c]pyrrole-1,3-diol is sourced from PubChem (CID 91438460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).