About tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate
tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate (PubChem CID 91439097) has the molecular formula C21H30N2O4
and a molecular weight of 374.48 g/mol. Its IUPAC name is tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate |
| PubChem CID | 91439097 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate |
| SMILES | CC(=O)OCCN1CC2(CCNCC2)c2cc(C(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C21H30N2O4/c1-15(24)26-12-11-23-14-21(7-9-22-10-8-21)17-13-16(5-6-18(17)23)19(25)27-20(2,3)4/h5-6,13,22H,7-12,14H2,1-4H3 |
| InChIKey | QETMSYSTAYTFDO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate?
The IUPAC name of tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate (CID 91439097) is tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate.
What is the SMILES notation for tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate?
The canonical SMILES for tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate is CC(=O)OCCN1CC2(CCNCC2)c2cc(C(=O)OC(C)(C)C)ccc21.
What is the InChIKey of tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate?
The InChIKey is QETMSYSTAYTFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O4/c1-15(24)26-12-11-23-14-21(7-9-22-10-8-21)17-13-16(5-6-18(17)23)19(25)27-20(2,3)4/h5-6,13,22H,7-12,14H2,1-4H3.
What are the key properties of tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate?
tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate has a molecular weight of 374.48 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-(2-acetyloxyethyl)spiro[2H-indole-3,4'-piperidine]-5-carboxylate is sourced from PubChem (CID 91439097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).