About CID 91439207
CID 91439207 (PubChem CID 91439207) has the molecular formula C28H34BN3O3
and a molecular weight of 471.41 g/mol.
Molecular Properties
| Compound Name | CID 91439207 |
| PubChem CID | 91439207 |
| Molecular Formula | C28H34BN3O3 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cc(C3=NC4(C5CCCN5C(=O)C(NC(=O)OC)C(C)C)CCC4CC3)ccc2c1 |
| InChI | InChI=1S/C28H34BN3O3/c1-17(2)25(30-27(34)35-3)26(33)32-14-4-5-24(32)28-13-12-21(28)9-11-23(31-28)20-7-6-19-16-22(29)10-8-18(19)15-20/h6-8,10,15-17,21,24-25H,4-5,9,11-14H2,1-3H3,(H,30,34) |
| InChIKey | ZFCXYROUFCZJGX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91439207 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91439207?
The IUPAC name of CID 91439207 (CID 91439207) is not available.
What is the SMILES notation for CID 91439207?
The canonical SMILES for CID 91439207 is [B]c1ccc2cc(C3=NC4(C5CCCN5C(=O)C(NC(=O)OC)C(C)C)CCC4CC3)ccc2c1.
What is the InChIKey of CID 91439207?
The InChIKey is ZFCXYROUFCZJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34BN3O3/c1-17(2)25(30-27(34)35-3)26(33)32-14-4-5-24(32)28-13-12-21(28)9-11-23(31-28)20-7-6-19-16-22(29)10-8-18(19)15-20/h6-8,10,15-17,21,24-25H,4-5,9,11-14H2,1-3H3,(H,30,34).
What are the key properties of CID 91439207?
CID 91439207 has a molecular weight of 471.41 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91439207 is sourced from PubChem (CID 91439207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).