About 4,4-dimethyloxazetidine
4,4-dimethyloxazetidine (PubChem CID 91439369) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is 4,4-dimethyloxazetidine.
Molecular Properties
| Compound Name | 4,4-dimethyloxazetidine |
| PubChem CID | 91439369 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | 4,4-dimethyloxazetidine |
| SMILES | CC1(C)CNO1 |
| InChI | InChI=1S/C4H9NO/c1-4(2)3-5-6-4/h5H,3H2,1-2H3 |
| InChIKey | POODLGOWROARDA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyloxazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyloxazetidine?
The IUPAC name of 4,4-dimethyloxazetidine (CID 91439369) is 4,4-dimethyloxazetidine.
What is the SMILES notation for 4,4-dimethyloxazetidine?
The canonical SMILES for 4,4-dimethyloxazetidine is CC1(C)CNO1.
What is the InChIKey of 4,4-dimethyloxazetidine?
The InChIKey is POODLGOWROARDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO/c1-4(2)3-5-6-4/h5H,3H2,1-2H3.
What are the key properties of 4,4-dimethyloxazetidine?
4,4-dimethyloxazetidine has a molecular weight of 87.12 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyloxazetidine is sourced from PubChem (CID 91439369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).