About (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate
(4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate (PubChem CID 91439745) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate |
| PubChem CID | 91439745 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2NO2/c1-11(2,3)15-10(16)17-8-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | WFSRDISYSVAVOT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate?
The IUPAC name of (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate (CID 91439745) is (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate.
What is the SMILES notation for (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate?
The canonical SMILES for (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate?
The InChIKey is WFSRDISYSVAVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO2/c1-11(2,3)15-10(16)17-8-9-4-6-12(13,14)7-5-9/h9H,4-8H2,1-3H3,(H,15,16).
What are the key properties of (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate?
(4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate has a molecular weight of 249.30 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)methyl N-tert-butylcarbamate is sourced from PubChem (CID 91439745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).