C30H35N3O6Si — CID 91440035
(6S,8R,8aS)-7-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-(4-methoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 91440035) has the molecular formula C30H35N3O6Si and a molecular weight of 561.71 g/mol. Its IUPAC name is (6S,8R,8aS)-7-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-(4-methoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8R,8aS)-7-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-(4-methoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 91440035 |
| Molecular Formula | C30H35N3O6Si |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | (6S,8R,8aS)-7-azido-6-[tert-butyl(diphenyl)silyl]oxy-2-(4-methoxyphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | COc1ccc(C2OCC3O[C@@H](O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(N=[N+]=[N-])[C@@H](O)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C30H35N3O6Si/c1-30(2,3)40(22-11-7-5-8-12-22,23-13-9-6-10-14-23)39-29-25(32-33-31)26(34)27-24(37-29)19-36-28(38-27)20-15-17-21(35-4)18-16-20/h5-18,24-29,34H,19H2,1-4H3/t24?,25?,26-,27-,28?,29+/m1/s1 |
| InChIKey | PMAWNQFNVGUJLK-FADFNWDOSA-N |
| XLogP | 4.45 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|