About 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol
6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol (PubChem CID 91440081) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol.
Analyze 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol (CID 91440081) is 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol is CC1CC(O)c2nccn2C1.
What is the InChIKey of 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The InChIKey is OVUAVNHIINKLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-4-7(11)8-9-2-3-10(8)5-6/h2-3,6-7,11H,4-5H2,1H3.
What are the key properties of 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol has a molecular weight of 152.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 91440081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).