C56H48N4O4 — CID 91440385
5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91440385) has the molecular formula C56H48N4O4 and a molecular weight of 841.02 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91440385 |
| Molecular Formula | C56H48N4O4 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.37 |
| IUPAC Name | 5,10,15,20-tetrakis(4-prop-2-enoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | C=CCOc1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCC=C)cc3)c3ccc([nH]3)C(c3ccc(OCC=C)cc3)=c3ccc([nH]3)=C(c3ccc(OCC=C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C56H48N4O4/c1-5-33-61-41-17-9-37(10-18-41)53-45-25-27-47(57-45)54(38-11-19-42(20-12-38)62-34-6-2)49-29-31-51(59-49)56(40-15-23-44(24-16-40)64-36-8-4)52-32-30-50(60-52)55(48-28-26-46(53)58-48)39-13-21-43(22-14-39)63-35-7-3/h5-32,57-60H,1-4,33-36H2 |
| InChIKey | LCZMUWFFMZPOLE-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|