About (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate
(1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate (PubChem CID 91440635) has the molecular formula C13H14N2O6S
and a molecular weight of 326.33 g/mol. Its IUPAC name is (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate.
Molecular Properties
| Compound Name | (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate |
| PubChem CID | 91440635 |
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate |
| SMILES | NC(=O)C1(OS(=O)(=O)N2CCOC2=O)CC1c1ccccc1 |
| InChI | InChI=1S/C13H14N2O6S/c14-11(16)13(8-10(13)9-4-2-1-3-5-9)21-22(18,19)15-6-7-20-12(15)17/h1-5,10H,6-8H2,(H2,14,16) |
| InChIKey | DWSNFHRIWVYJSJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate?
The IUPAC name of (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate (CID 91440635) is (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate.
What is the SMILES notation for (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate?
The canonical SMILES for (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate is NC(=O)C1(OS(=O)(=O)N2CCOC2=O)CC1c1ccccc1.
What is the InChIKey of (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate?
The InChIKey is DWSNFHRIWVYJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O6S/c14-11(16)13(8-10(13)9-4-2-1-3-5-9)21-22(18,19)15-6-7-20-12(15)17/h1-5,10H,6-8H2,(H2,14,16).
What are the key properties of (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate?
(1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate has a molecular weight of 326.33 g/mol, XLogP of 0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoyl-2-phenylcyclopropyl) 2-oxo-1,3-oxazolidine-3-sulfonate is sourced from PubChem (CID 91440635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).