About [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite
[10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite (PubChem CID 91441145) has the molecular formula C13H20N2O4
and a molecular weight of 268.31 g/mol. Its IUPAC name is [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite.
Molecular Properties
| Compound Name | [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite |
| PubChem CID | 91441145 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite |
| SMILES | C=CC(CCC=CC(CON=O)CC(=C)C)ON=O |
| InChI | InChI=1S/C13H20N2O4/c1-4-13(19-15-17)8-6-5-7-12(9-11(2)3)10-18-14-16/h4-5,7,12-13H,1-2,6,8-10H2,3H3 |
| InChIKey | QEYNJUAGDKJZMO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite?
The IUPAC name of [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite (CID 91441145) is [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite.
What is the SMILES notation for [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite?
The canonical SMILES for [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite is C=CC(CCC=CC(CON=O)CC(=C)C)ON=O.
What is the InChIKey of [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite?
The InChIKey is QEYNJUAGDKJZMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4/c1-4-13(19-15-17)8-6-5-7-12(9-11(2)3)10-18-14-16/h4-5,7,12-13H,1-2,6,8-10H2,3H3.
What are the key properties of [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite?
[10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite has a molecular weight of 268.31 g/mol, XLogP of 3.86, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [10-methyl-8-(nitrosooxymethyl)undeca-1,6,10-trien-3-yl] nitrite is sourced from PubChem (CID 91441145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).