C19H18N2O2 — CID 914415
1-[(4-methyl-2-pyridinyl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol (PubChem CID 914415) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-[(4-methyl-2-pyridinyl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol.
| Compound Name | 1-[(4-methyl-2-pyridinyl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
|---|---|
| PubChem CID | 914415 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[(4-methyl-2-pyridinyl)iminomethyl]-6,7,8,9-tetrahydrodibenzofuran-2-ol |
| SMILES | Cc1ccnc(/N=C/c2c(O)ccc3oc4c(c23)CCCC4)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-12-8-9-20-18(10-12)21-11-14-15(22)6-7-17-19(14)13-4-2-3-5-16(13)23-17/h6-11,22H,2-5H2,1H3/b21-11+ |
| InChIKey | OYPNGOUOGCXDNR-SRZZPIQSSA-N |
| XLogP | 4.47 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|