C24H24N2O2 — CID 91441594
2-[6-[2-[(3aR,4S,5R,6S,7aS)-5,6-dimethyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-4-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 91441594) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[6-[2-[(3aR,4S,5R,6S,7aS)-5,6-dimethyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-4-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[2-[(3aR,4S,5R,6S,7aS)-5,6-dimethyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 91441594 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[6-[2-[(3aR,4S,5R,6S,7aS)-5,6-dimethyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3ccccc3C#N)cn2)[C@H]2C(=O)OC[C@H]2C[C@@H]1C |
| InChI | InChI=1S/C24H24N2O2/c1-15-11-19-14-28-24(27)23(19)21(16(15)2)10-9-20-8-7-18(13-26-20)22-6-4-3-5-17(22)12-25/h3-10,13,15-16,19,21,23H,11,14H2,1-2H3/t15-,16+,19+,21-,23-/m0/s1 |
| InChIKey | ZCIMWMNZPLHPNQ-DKOXFKRDSA-N |
| XLogP | 4.71 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |