C30H38FN3O6 — CID 91441709
tert-butyl 2-[(4R,6R)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 91441709) has the molecular formula C30H38FN3O6 and a molecular weight of 555.65 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6R)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6R)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 91441709 |
| Molecular Formula | C30H38FN3O6 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | tert-butyl 2-[(4R,6R)-6-[2-[[5-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(F)cc32)c(C)c1C(=O)NCC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C30H38FN3O6/c1-16-24(15-22-21-12-18(31)8-9-23(21)34-27(22)36)33-17(2)26(16)28(37)32-11-10-19-13-20(39-30(6,7)38-19)14-25(35)40-29(3,4)5/h8-9,12,15,19-20,33H,10-11,13-14H2,1-7H3,(H,32,37)(H,34,36)/t19-,20-/m1/s1 |
| InChIKey | WKVUXDQIMUOAJN-WOJBJXKFSA-N |
| XLogP | 5.03 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|