About (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one
(5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one (PubChem CID 91441810) has the molecular formula C10H15F2NO
and a molecular weight of 203.23 g/mol. Its IUPAC name is (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one.
Molecular Properties
| Compound Name | (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one |
| PubChem CID | 91441810 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one |
| SMILES | O=C1CN[C@H](C2CCC(F)C(F)C2)C1 |
| InChI | InChI=1S/C10H15F2NO/c11-8-2-1-6(3-9(8)12)10-4-7(14)5-13-10/h6,8-10,13H,1-5H2/t6?,8?,9?,10-/m0/s1 |
| InChIKey | ACFRCHNITOVBJE-FCJLCZJYSA-N |
| XLogP | 1.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one?
The IUPAC name of (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one (CID 91441810) is (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one.
What is the SMILES notation for (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one?
The canonical SMILES for (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one is O=C1CN[C@H](C2CCC(F)C(F)C2)C1.
What is the InChIKey of (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one?
The InChIKey is ACFRCHNITOVBJE-FCJLCZJYSA-N. The full InChI is InChI=1S/C10H15F2NO/c11-8-2-1-6(3-9(8)12)10-4-7(14)5-13-10/h6,8-10,13H,1-5H2/t6?,8?,9?,10-/m0/s1.
What are the key properties of (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one?
(5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one has a molecular weight of 203.23 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(3,4-difluorocyclohexyl)pyrrolidin-3-one is sourced from PubChem (CID 91441810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).