About 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one
3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one (PubChem CID 91442192) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one |
| PubChem CID | 91442192 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one |
| SMILES | Cc1cn(C(=O)C=CN(C)C)c(C)n1 |
| InChI | InChI=1S/C10H15N3O/c1-8-7-13(9(2)11-8)10(14)5-6-12(3)4/h5-7H,1-4H3 |
| InChIKey | MJGLCEIFMGSFOX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one?
The IUPAC name of 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one (CID 91442192) is 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one.
What is the SMILES notation for 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one?
The canonical SMILES for 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one is Cc1cn(C(=O)C=CN(C)C)c(C)n1.
What is the InChIKey of 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one?
The InChIKey is MJGLCEIFMGSFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-8-7-13(9(2)11-8)10(14)5-6-12(3)4/h5-7H,1-4H3.
What are the key properties of 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one?
3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one has a molecular weight of 193.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-1-(2,4-dimethylimidazol-1-yl)prop-2-en-1-one is sourced from PubChem (CID 91442192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).