C19H14Cl2N4O2S — CID 91442345
4-amino-N-[2-(1H-benzimidazol-2-yl)phenyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 91442345) has the molecular formula C19H14Cl2N4O2S and a molecular weight of 433.32 g/mol. Its IUPAC name is 4-amino-N-[2-(1H-benzimidazol-2-yl)phenyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | 4-amino-N-[2-(1H-benzimidazol-2-yl)phenyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 91442345 |
| Molecular Formula | C19H14Cl2N4O2S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 4-amino-N-[2-(1H-benzimidazol-2-yl)phenyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)Nc2ccccc2-c2nc3ccccc3[nH]2)cc1Cl |
| InChI | InChI=1S/C19H14Cl2N4O2S/c20-12-10-18(13(21)9-14(12)22)28(26,27)25-15-6-2-1-5-11(15)19-23-16-7-3-4-8-17(16)24-19/h1-10,25H,22H2,(H,23,24) |
| InChIKey | BWOKCNKXZLGJGT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|