About 1-methylimidazol-1-ium-1,4-dicarboxamide
1-methylimidazol-1-ium-1,4-dicarboxamide (PubChem CID 91442529) has the molecular formula C6H9N4O2+
and a molecular weight of 169.16 g/mol. Its IUPAC name is 1-methylimidazol-1-ium-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-methylimidazol-1-ium-1,4-dicarboxamide |
| PubChem CID | 91442529 |
| Molecular Formula | C6H9N4O2+ |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-methylimidazol-1-ium-1,4-dicarboxamide |
| SMILES | C[N+]1(C(N)=O)C=NC(C(N)=O)=C1 |
| InChI | InChI=1S/C6H8N4O2/c1-10(6(8)12)2-4(5(7)11)9-3-10/h2-3H,1H3,(H3-,7,8,11,12)/p+1 |
| InChIKey | MKLOSQMEDHFHPM-UHFFFAOYSA-O |
| XLogP | -1.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylimidazol-1-ium-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazol-1-ium-1,4-dicarboxamide?
The IUPAC name of 1-methylimidazol-1-ium-1,4-dicarboxamide (CID 91442529) is 1-methylimidazol-1-ium-1,4-dicarboxamide.
What is the SMILES notation for 1-methylimidazol-1-ium-1,4-dicarboxamide?
The canonical SMILES for 1-methylimidazol-1-ium-1,4-dicarboxamide is C[N+]1(C(N)=O)C=NC(C(N)=O)=C1.
What is the InChIKey of 1-methylimidazol-1-ium-1,4-dicarboxamide?
The InChIKey is MKLOSQMEDHFHPM-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N4O2/c1-10(6(8)12)2-4(5(7)11)9-3-10/h2-3H,1H3,(H3-,7,8,11,12)/p+1.
What are the key properties of 1-methylimidazol-1-ium-1,4-dicarboxamide?
1-methylimidazol-1-ium-1,4-dicarboxamide has a molecular weight of 169.16 g/mol, XLogP of -1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazol-1-ium-1,4-dicarboxamide is sourced from PubChem (CID 91442529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).