C16H19NO4 — CID 914431
4-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzoic acid (PubChem CID 914431) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzoic acid.
| Compound Name | 4-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzoic acid |
|---|---|
| PubChem CID | 914431 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[2-(4,4,5,5-tetramethyl-1,3-dioxolan-2-ylidene)ethylideneamino]benzoic acid |
| SMILES | CC1(C)OC(=C/C=N/c2ccc(C(=O)O)cc2)OC1(C)C |
| InChI | InChI=1S/C16H19NO4/c1-15(2)16(3,4)21-13(20-15)9-10-17-12-7-5-11(6-8-12)14(18)19/h5-10H,1-4H3,(H,18,19)/b17-10+ |
| InChIKey | BLQCAASKKVFUAV-LICLKQGHSA-N |
| XLogP | 3.53 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|