C6H8Br2O — CID 91443105
1,1-dibromo-3-cyclopropylpropan-2-one (PubChem CID 91443105) has the molecular formula C6H8Br2O and a molecular weight of 255.94 g/mol. Its IUPAC name is 1,1-dibromo-3-cyclopropylpropan-2-one.
| Compound Name | 1,1-dibromo-3-cyclopropylpropan-2-one |
|---|---|
| PubChem CID | 91443105 |
| Molecular Formula | C6H8Br2O |
| Molecular Weight | 255.94 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 1,1-dibromo-3-cyclopropylpropan-2-one |
| SMILES | O=C(CC1CC1)C(Br)Br |
| InChI | InChI=1S/C6H8Br2O/c7-6(8)5(9)3-4-1-2-4/h4,6H,1-3H2 |
| InChIKey | DCHKTRMFRFZDAJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|