About 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin
5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin (PubChem CID 91443446) has the molecular formula C27H26N6O2
and a molecular weight of 466.55 g/mol. Its IUPAC name is 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin.
Molecular Properties
| Compound Name | 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin |
| PubChem CID | 91443446 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin |
| SMILES | CCC1=c2ccc([nH]2)=C(c2ncc[nH]2)c2ccc(n2OC)C=c2ccc([nH]2)=Cc2ccc1n2OC |
| InChI | InChI=1S/C27H26N6O2/c1-4-21-22-9-10-23(31-22)26(27-28-13-14-29-27)25-12-8-20(33(25)35-3)16-18-6-5-17(30-18)15-19-7-11-24(21)32(19)34-2/h5-16,30-31H,4H2,1-3H3,(H,28,29) |
| InChIKey | FANZHKRHPJUVMW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin?
The IUPAC name of 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin (CID 91443446) is 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin.
What is the SMILES notation for 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin?
The canonical SMILES for 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin is CCC1=c2ccc([nH]2)=C(c2ncc[nH]2)c2ccc(n2OC)C=c2ccc([nH]2)=Cc2ccc1n2OC.
What is the InChIKey of 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin?
The InChIKey is FANZHKRHPJUVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N6O2/c1-4-21-22-9-10-23(31-22)26(27-28-13-14-29-27)25-12-8-20(33(25)35-3)16-18-6-5-17(30-18)15-19-7-11-24(21)32(19)34-2/h5-16,30-31H,4H2,1-3H3,(H,28,29).
What are the key properties of 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin?
5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin has a molecular weight of 466.55 g/mol, XLogP of 0.61, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-20-(1H-imidazol-2-yl)-22,24-dimethoxy-21,23-dihydroporphyrin is sourced from PubChem (CID 91443446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).