C54H72N12O3 — CID 91443769
6-[4-[3,5-bis[4-(2,4-ditert-butyl-3-oxo-1H-1,2,4,5-tetrazin-6-yl)phenyl]phenyl]phenyl]-2,4-ditert-butyl-1H-1,2,4,5-tetrazin-3-one (PubChem CID 91443769) has the molecular formula C54H72N12O3 and a molecular weight of 937.25 g/mol. Its IUPAC name is 6-[4-[3,5-bis[4-(2,4-ditert-butyl-3-oxo-1H-1,2,4,5-tetrazin-6-yl)phenyl]phenyl]phenyl]-2,4-ditert-butyl-1H-1,2,4,5-tetrazin-3-one.
| Compound Name | 6-[4-[3,5-bis[4-(2,4-ditert-butyl-3-oxo-1H-1,2,4,5-tetrazin-6-yl)phenyl]phenyl]phenyl]-2,4-ditert-butyl-1H-1,2,4,5-tetrazin-3-one |
|---|---|
| PubChem CID | 91443769 |
| Molecular Formula | C54H72N12O3 |
| Molecular Weight | 937.25 g/mol |
| Exact Mass | 936.59 |
| IUPAC Name | 6-[4-[3,5-bis[4-(2,4-ditert-butyl-3-oxo-1H-1,2,4,5-tetrazin-6-yl)phenyl]phenyl]phenyl]-2,4-ditert-butyl-1H-1,2,4,5-tetrazin-3-one |
| SMILES | CC(C)(C)N1N=C(c2ccc(-c3cc(-c4ccc(C5=NN(C(C)(C)C)C(=O)N(C(C)(C)C)N5)cc4)cc(-c4ccc(C5=NN(C(C)(C)C)C(=O)N(C(C)(C)C)N5)cc4)c3)cc2)NN(C(C)(C)C)C1=O |
| InChI | InChI=1S/C54H72N12O3/c1-49(2,3)61-46(67)62(50(4,5)6)56-43(55-61)37-25-19-34(20-26-37)40-31-41(35-21-27-38(28-22-35)44-57-63(51(7,8)9)47(68)64(58-44)52(10,11)12)33-42(32-40)36-23-29-39(30-24-36)45-59-65(53(13,14)15)48(69)66(60-45)54(16,17)18/h19-33H,1-18H3,(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | JUXSIDVWUKMKCL-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.25 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |