C32H44NO2S+ — CID 91443837
13-butyl-7-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-9,9-diethyl-5-methyl-4-(3-methylbuta-1,3-dienyl)-3-thia-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene (PubChem CID 91443837) has the molecular formula C32H44NO2S+ and a molecular weight of 506.78 g/mol. Its IUPAC name is 13-butyl-7-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-9,9-diethyl-5-methyl-4-(3-methylbuta-1,3-dienyl)-3-thia-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene.
| Compound Name | 13-butyl-7-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-9,9-diethyl-5-methyl-4-(3-methylbuta-1,3-dienyl)-3-thia-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene |
|---|---|
| PubChem CID | 91443837 |
| Molecular Formula | C32H44NO2S+ |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 13-butyl-7-(4,6-dimethyl-4H-1,3-dioxin-2-yl)-9,9-diethyl-5-methyl-4-(3-methylbuta-1,3-dienyl)-3-thia-10-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene |
| SMILES | C=C(C)C=Cc1sc2c(c1C)C(C1OC(C)=CC(C)O1)CC(CC)(CC)[n+]1ccc(CCCC)cc1-2 |
| InChI | InChI=1S/C32H44NO2S/c1-9-12-13-25-16-17-33-27(19-25)30-29(24(8)28(36-30)15-14-21(4)5)26(20-32(33,10-2)11-3)31-34-22(6)18-23(7)35-31/h14-19,22,26,31H,4,9-13,20H2,1-3,5-8H3/q+1 |
| InChIKey | ISOIEICSDMHYGX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|