About 2-hydroxy-1,3-oxazolidin-5-one
2-hydroxy-1,3-oxazolidin-5-one (PubChem CID 91444204) has the molecular formula C3H5NO3
and a molecular weight of 103.08 g/mol. Its IUPAC name is 2-hydroxy-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-1,3-oxazolidin-5-one |
| PubChem CID | 91444204 |
| Molecular Formula | C3H5NO3 |
| Molecular Weight | 103.08 g/mol |
| Exact Mass | 103.03 |
| IUPAC Name | 2-hydroxy-1,3-oxazolidin-5-one |
| SMILES | O=C1CNC(O)O1 |
| InChI | InChI=1S/C3H5NO3/c5-2-1-4-3(6)7-2/h3-4,6H,1H2 |
| InChIKey | SBXTYSOPGWTSKD-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.08 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,3-oxazolidin-5-one?
The IUPAC name of 2-hydroxy-1,3-oxazolidin-5-one (CID 91444204) is 2-hydroxy-1,3-oxazolidin-5-one.
What is the SMILES notation for 2-hydroxy-1,3-oxazolidin-5-one?
The canonical SMILES for 2-hydroxy-1,3-oxazolidin-5-one is O=C1CNC(O)O1.
What is the InChIKey of 2-hydroxy-1,3-oxazolidin-5-one?
The InChIKey is SBXTYSOPGWTSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO3/c5-2-1-4-3(6)7-2/h3-4,6H,1H2.
What are the key properties of 2-hydroxy-1,3-oxazolidin-5-one?
2-hydroxy-1,3-oxazolidin-5-one has a molecular weight of 103.08 g/mol, XLogP of -1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,3-oxazolidin-5-one is sourced from PubChem (CID 91444204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).