C31H26FN5O — CID 91444450
1-benzyl-2-(4-fluorophenyl)-5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzimidazol-4-amine (PubChem CID 91444450) has the molecular formula C31H26FN5O and a molecular weight of 503.58 g/mol. Its IUPAC name is 1-benzyl-2-(4-fluorophenyl)-5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzimidazol-4-amine.
| Compound Name | 1-benzyl-2-(4-fluorophenyl)-5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzimidazol-4-amine |
|---|---|
| PubChem CID | 91444450 |
| Molecular Formula | C31H26FN5O |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 1-benzyl-2-(4-fluorophenyl)-5-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]benzimidazol-4-amine |
| SMILES | COc1cc(-c2ccc3c(nc(-c4ccc(F)cc4)n3Cc3ccccc3)c2N)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C31H26FN5O/c1-20-17-36(19-34-20)26-14-10-23(16-28(26)38-2)25-13-15-27-30(29(25)33)35-31(22-8-11-24(32)12-9-22)37(27)18-21-6-4-3-5-7-21/h3-17,19H,18,33H2,1-2H3 |
| InChIKey | VBFPGKRHAHXREA-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|