molecular fluorine;1,2,2-trifluorooct-7-en-4-ol

C8H13F5O — CID 91444562

IUPACmolecular fluorine;1,2,2-trifluorooct-7-en-4-ol
SMILESC=CCCC(O)CC(F)(F)CF.FF
InChIInChI=1S/C8H13F3O.F2/c1-2-3-4-7(12)5-8(10,11)6-9;1-2/h2,7,12H,1,3-6H2;
InChIKeyFGXLONBAKFIJTF-UHFFFAOYSA-N
MW220.18 g/mol
LogP3.15
Rot. Bonds6

About molecular fluorine;1,2,2-trifluorooct-7-en-4-ol

molecular fluorine;1,2,2-trifluorooct-7-en-4-ol (PubChem CID 91444562) has the molecular formula C8H13F5O and a molecular weight of 220.18 g/mol. Its IUPAC name is molecular fluorine;1,2,2-trifluorooct-7-en-4-ol.

Molecular Properties

Compound Namemolecular fluorine;1,2,2-trifluorooct-7-en-4-ol
PubChem CID91444562
Molecular FormulaC8H13F5O
Molecular Weight220.18 g/mol
Exact Mass220.09
IUPAC Namemolecular fluorine;1,2,2-trifluorooct-7-en-4-ol
SMILESC=CCCC(O)CC(F)(F)CF.FF
InChIInChI=1S/C8H13F3O.F2/c1-2-3-4-7(12)5-8(10,11)6-9;1-2/h2,7,12H,1,3-6H2;
InChIKeyFGXLONBAKFIJTF-UHFFFAOYSA-N
XLogP3.15
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.18
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze molecular fluorine;1,2,2-trifluorooct-7-en-4-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular fluorine;1,2,2-trifluorooct-7-en-4-ol?
The IUPAC name of molecular fluorine;1,2,2-trifluorooct-7-en-4-ol (CID 91444562) is molecular fluorine;1,2,2-trifluorooct-7-en-4-ol.
What is the SMILES notation for molecular fluorine;1,2,2-trifluorooct-7-en-4-ol?
The canonical SMILES for molecular fluorine;1,2,2-trifluorooct-7-en-4-ol is C=CCCC(O)CC(F)(F)CF.FF.
What is the InChIKey of molecular fluorine;1,2,2-trifluorooct-7-en-4-ol?
The InChIKey is FGXLONBAKFIJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O.F2/c1-2-3-4-7(12)5-8(10,11)6-9;1-2/h2,7,12H,1,3-6H2;.
What are the key properties of molecular fluorine;1,2,2-trifluorooct-7-en-4-ol?
molecular fluorine;1,2,2-trifluorooct-7-en-4-ol has a molecular weight of 220.18 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular fluorine;1,2,2-trifluorooct-7-en-4-ol is sourced from PubChem (CID 91444562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).