About N,2-dimethyl-3-(methylamino)propanamide;ethenone
N,2-dimethyl-3-(methylamino)propanamide;ethenone (PubChem CID 91444745) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is N,2-dimethyl-3-(methylamino)propanamide;ethenone.
Molecular Properties
| Compound Name | N,2-dimethyl-3-(methylamino)propanamide;ethenone |
| PubChem CID | 91444745 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N,2-dimethyl-3-(methylamino)propanamide;ethenone |
| SMILES | C=C=O.CNCC(C)C(=O)NC |
| InChI | InChI=1S/C6H14N2O.C2H2O/c1-5(4-7-2)6(9)8-3;1-2-3/h5,7H,4H2,1-3H3,(H,8,9);1H2 |
| InChIKey | WENRNWYWYNPJAP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-3-(methylamino)propanamide;ethenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-3-(methylamino)propanamide;ethenone?
The IUPAC name of N,2-dimethyl-3-(methylamino)propanamide;ethenone (CID 91444745) is N,2-dimethyl-3-(methylamino)propanamide;ethenone.
What is the SMILES notation for N,2-dimethyl-3-(methylamino)propanamide;ethenone?
The canonical SMILES for N,2-dimethyl-3-(methylamino)propanamide;ethenone is C=C=O.CNCC(C)C(=O)NC.
What is the InChIKey of N,2-dimethyl-3-(methylamino)propanamide;ethenone?
The InChIKey is WENRNWYWYNPJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C2H2O/c1-5(4-7-2)6(9)8-3;1-2-3/h5,7H,4H2,1-3H3,(H,8,9);1H2.
What are the key properties of N,2-dimethyl-3-(methylamino)propanamide;ethenone?
N,2-dimethyl-3-(methylamino)propanamide;ethenone has a molecular weight of 172.23 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-3-(methylamino)propanamide;ethenone is sourced from PubChem (CID 91444745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).