C18H25B4N5O2 — CID 91445374
CID 91445374 (PubChem CID 91445374) has the molecular formula C18H25B4N5O2 and a molecular weight of 386.68 g/mol.
| Compound Name | CID 91445374 |
|---|---|
| PubChem CID | 91445374 |
| Molecular Formula | C18H25B4N5O2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | — |
| SMILES | CN1CCN(C(=O)N2CCC(n3c(=O)[nH]c4ccccc43)CC2)CC1.[B]B([B])[B] |
| InChI | InChI=1S/C18H25N5O2.B4/c1-20-10-12-22(13-11-20)18(25)21-8-6-14(7-9-21)23-16-5-3-2-4-15(16)19-17(23)24;1-4(2)3/h2-5,14H,6-13H2,1H3,(H,19,24); |
| InChIKey | XEKQHAZBOUUCIP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|