About 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid
2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid (PubChem CID 91445398) has the molecular formula C19H15Br2NO4
and a molecular weight of 481.14 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid |
| PubChem CID | 91445398 |
| Molecular Formula | C19H15Br2NO4 |
| Molecular Weight | 481.14 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid |
| SMILES | O=C(O)CN(Cc1cc(Br)c(O)c(Br)c1O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15Br2NO4/c20-15-8-13(18(25)17(21)19(15)26)9-22(10-16(23)24)14-6-5-11-3-1-2-4-12(11)7-14/h1-8,25-26H,9-10H2,(H,23,24) |
| InChIKey | UUBIJHZVBFLCJB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.14 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid?
The IUPAC name of 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid (CID 91445398) is 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid.
What is the SMILES notation for 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid?
The canonical SMILES for 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid is O=C(O)CN(Cc1cc(Br)c(O)c(Br)c1O)c1ccc2ccccc2c1.
What is the InChIKey of 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid?
The InChIKey is UUBIJHZVBFLCJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Br2NO4/c20-15-8-13(18(25)17(21)19(15)26)9-22(10-16(23)24)14-6-5-11-3-1-2-4-12(11)7-14/h1-8,25-26H,9-10H2,(H,23,24).
What are the key properties of 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid?
2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid has a molecular weight of 481.14 g/mol, XLogP of 4.87, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dibromo-2,4-dihydroxyphenyl)methyl-naphthalen-2-ylamino]acetic acid is sourced from PubChem (CID 91445398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).