C13H13ClN2O5 — CID 91445949
5-[(2-chloro-6-methoxy-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 91445949) has the molecular formula C13H13ClN2O5 and a molecular weight of 312.71 g/mol. Its IUPAC name is 5-[(2-chloro-6-methoxy-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2-chloro-6-methoxy-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 91445949 |
| Molecular Formula | C13H13ClN2O5 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-[(2-chloro-6-methoxy-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(/N=C/C2C(=O)OC(C)(C)OC2=O)c(Cl)n1 |
| InChI | InChI=1S/C13H13ClN2O5/c1-13(2)20-11(17)7(12(18)21-13)6-15-8-4-5-9(19-3)16-10(8)14/h4-7H,1-3H3/b15-6+ |
| InChIKey | CZMOFVBRSFMVFQ-GIDUJCDVSA-N |
| XLogP | 1.90 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|