About (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane
(2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane (PubChem CID 91446102) has the molecular formula C15H32Si
and a molecular weight of 240.51 g/mol. Its IUPAC name is (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane.
Molecular Properties
| Compound Name | (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane |
| PubChem CID | 91446102 |
| Molecular Formula | C15H32Si |
| Molecular Weight | 240.51 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane |
| SMILES | CC(C(=C[Si](C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32Si/c1-12(14(2,3)4)13(15(5,6)7)11-16(8,9)10/h11-12H,1-10H3 |
| InChIKey | XEPCULUSPABRBA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane?
The IUPAC name of (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane (CID 91446102) is (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane.
What is the SMILES notation for (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane?
The canonical SMILES for (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane is CC(C(=C[Si](C)(C)C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane?
The InChIKey is XEPCULUSPABRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32Si/c1-12(14(2,3)4)13(15(5,6)7)11-16(8,9)10/h11-12H,1-10H3.
What are the key properties of (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane?
(2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane has a molecular weight of 240.51 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-3,4,4-trimethylpent-1-enyl)-trimethylsilane is sourced from PubChem (CID 91446102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).