C16H24 — CID 91447117
1,8-dimethylnaphthalene;ethane (PubChem CID 91447117) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,8-dimethylnaphthalene;ethane.
| Compound Name | 1,8-dimethylnaphthalene;ethane |
|---|---|
| PubChem CID | 91447117 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,8-dimethylnaphthalene;ethane |
| SMILES | CC.CC.Cc1cccc2cccc(C)c12 |
| InChI | InChI=1S/C12H12.2C2H6/c1-9-5-3-7-11-8-4-6-10(2)12(9)11;2*1-2/h3-8H,1-2H3;2*1-2H3 |
| InChIKey | OUYRIFFLZNTCCF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |