About [(2S)-2-methoxypropyl] N-tert-butylcarbamate
[(2S)-2-methoxypropyl] N-tert-butylcarbamate (PubChem CID 91447242) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is [(2S)-2-methoxypropyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(2S)-2-methoxypropyl] N-tert-butylcarbamate |
| PubChem CID | 91447242 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | [(2S)-2-methoxypropyl] N-tert-butylcarbamate |
| SMILES | CO[C@@H](C)COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H19NO3/c1-7(12-5)6-13-8(11)10-9(2,3)4/h7H,6H2,1-5H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | LROZCBQYGKTIPZ-ZETCQYMHSA-N |
| XLogP | 1.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-methoxypropyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-methoxypropyl] N-tert-butylcarbamate?
The IUPAC name of [(2S)-2-methoxypropyl] N-tert-butylcarbamate (CID 91447242) is [(2S)-2-methoxypropyl] N-tert-butylcarbamate.
What is the SMILES notation for [(2S)-2-methoxypropyl] N-tert-butylcarbamate?
The canonical SMILES for [(2S)-2-methoxypropyl] N-tert-butylcarbamate is CO[C@@H](C)COC(=O)NC(C)(C)C.
What is the InChIKey of [(2S)-2-methoxypropyl] N-tert-butylcarbamate?
The InChIKey is LROZCBQYGKTIPZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H19NO3/c1-7(12-5)6-13-8(11)10-9(2,3)4/h7H,6H2,1-5H3,(H,10,11)/t7-/m0/s1.
What are the key properties of [(2S)-2-methoxypropyl] N-tert-butylcarbamate?
[(2S)-2-methoxypropyl] N-tert-butylcarbamate has a molecular weight of 189.25 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-methoxypropyl] N-tert-butylcarbamate is sourced from PubChem (CID 91447242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).