About 3,9-dimethyl-2,3-dihydroacridine
3,9-dimethyl-2,3-dihydroacridine (PubChem CID 91447296) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,9-dimethyl-2,3-dihydroacridine.
Molecular Properties
| Compound Name | 3,9-dimethyl-2,3-dihydroacridine |
| PubChem CID | 91447296 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3,9-dimethyl-2,3-dihydroacridine |
| SMILES | Cc1c2c(nc3ccccc13)=CC(C)CC=2 |
| InChI | InChI=1S/C15H15N/c1-10-7-8-13-11(2)12-5-3-4-6-14(12)16-15(13)9-10/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | GGECRJUFYBSZMF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,9-dimethyl-2,3-dihydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dimethyl-2,3-dihydroacridine?
The IUPAC name of 3,9-dimethyl-2,3-dihydroacridine (CID 91447296) is 3,9-dimethyl-2,3-dihydroacridine.
What is the SMILES notation for 3,9-dimethyl-2,3-dihydroacridine?
The canonical SMILES for 3,9-dimethyl-2,3-dihydroacridine is Cc1c2c(nc3ccccc13)=CC(C)CC=2.
What is the InChIKey of 3,9-dimethyl-2,3-dihydroacridine?
The InChIKey is GGECRJUFYBSZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-10-7-8-13-11(2)12-5-3-4-6-14(12)16-15(13)9-10/h3-6,8-10H,7H2,1-2H3.
What are the key properties of 3,9-dimethyl-2,3-dihydroacridine?
3,9-dimethyl-2,3-dihydroacridine has a molecular weight of 209.29 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dimethyl-2,3-dihydroacridine is sourced from PubChem (CID 91447296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).