C13H14O6 — CID 91447695
3-(1-hydroxy-7-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-5-yl)oxolane-2,5-dione (PubChem CID 91447695) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-(1-hydroxy-7-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-5-yl)oxolane-2,5-dione.
| Compound Name | 3-(1-hydroxy-7-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-5-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 91447695 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-(1-hydroxy-7-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-5-yl)oxolane-2,5-dione |
| SMILES | CC1=CC(C2CC(=O)OC2=O)CC2C(=O)OC(O)C12 |
| InChI | InChI=1S/C13H14O6/c1-5-2-6(7-4-9(14)18-11(7)15)3-8-10(5)13(17)19-12(8)16/h2,6-8,10,13,17H,3-4H2,1H3 |
| InChIKey | MNVWOQFMNHNJCB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|