About N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine
N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 91447993) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 91447993 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | CN(C)c1cnn2cccnc12 |
| InChI | InChI=1S/C8H10N4/c1-11(2)7-6-10-12-5-3-4-9-8(7)12/h3-6H,1-2H3 |
| InChIKey | HHQUYFWTXJQYFW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine (CID 91447993) is N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine is CN(C)c1cnn2cccnc12.
What is the InChIKey of N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is HHQUYFWTXJQYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-11(2)7-6-10-12-5-3-4-9-8(7)12/h3-6H,1-2H3.
What are the key properties of N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine?
N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 162.20 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 91447993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).