C29H35F2N3O2+2 — CID 91448309
3-(6,6-diethyl-10,12-difluoro-2-hexyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-3,6-dihydroimidazo[1,5-c][1,3]oxazol-4-ium-1-one (PubChem CID 91448309) has the molecular formula C29H35F2N3O2+2 and a molecular weight of 495.61 g/mol. Its IUPAC name is 3-(6,6-diethyl-10,12-difluoro-2-hexyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-3,6-dihydroimidazo[1,5-c][1,3]oxazol-4-ium-1-one.
| Compound Name | 3-(6,6-diethyl-10,12-difluoro-2-hexyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-3,6-dihydroimidazo[1,5-c][1,3]oxazol-4-ium-1-one |
|---|---|
| PubChem CID | 91448309 |
| Molecular Formula | C29H35F2N3O2+2 |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 3-(6,6-diethyl-10,12-difluoro-2-hexyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-3,6-dihydroimidazo[1,5-c][1,3]oxazol-4-ium-1-one |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(F)cc(F)cc1C(C1OC(=O)c3c[nH]c[n+]31)CC2(CC)CC |
| InChI | InChI=1S/C29H34F2N3O2/c1-4-7-8-9-10-19-11-12-34-24(13-19)26-21(14-20(30)15-23(26)31)22(16-29(34,5-2)6-3)27-33-18-32-17-25(33)28(35)36-27/h11-15,17-18,22,27H,4-10,16H2,1-3H3/q+1/p+1 |
| InChIKey | REVVULGDKNRTRF-UHFFFAOYSA-O |
| XLogP | 6.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|