C20H22FN3O4 — CID 9144857
4-fluoro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-nitrobenzamide (PubChem CID 9144857) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-fluoro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-nitrobenzamide.
| Compound Name | 4-fluoro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9144857 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-fluoro-N-[(1R)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-nitrobenzamide |
| SMILES | Cc1ccc([C@H](CN2CCOCC2)NC(=O)c2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H22FN3O4/c1-14-2-4-15(5-3-14)18(13-23-8-10-28-11-9-23)22-20(25)16-6-7-17(21)19(12-16)24(26)27/h2-7,12,18H,8-11,13H2,1H3,(H,22,25)/t18-/m0/s1 |
| InChIKey | ARPUNHNIPSIUBK-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|