About 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide
2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide (PubChem CID 91449110) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide |
| PubChem CID | 91449110 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide |
| SMILES | Cc1[nH]nc2cc(C3CC34C(=O)N(CC(N)=O)c3ccccc34)ccc12 |
| InChI | InChI=1S/C20H18N4O2/c1-11-13-7-6-12(8-16(13)23-22-11)15-9-20(15)14-4-2-3-5-17(14)24(19(20)26)10-18(21)25/h2-8,15H,9-10H2,1H3,(H2,21,25)(H,22,23) |
| InChIKey | VQKAHRCXQUAVNK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide?
The IUPAC name of 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide (CID 91449110) is 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide.
What is the SMILES notation for 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide?
The canonical SMILES for 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide is Cc1[nH]nc2cc(C3CC34C(=O)N(CC(N)=O)c3ccccc34)ccc12.
What is the InChIKey of 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide?
The InChIKey is VQKAHRCXQUAVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-11-13-7-6-12(8-16(13)23-22-11)15-9-20(15)14-4-2-3-5-17(14)24(19(20)26)10-18(21)25/h2-8,15H,9-10H2,1H3,(H2,21,25)(H,22,23).
What are the key properties of 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide?
2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide has a molecular weight of 346.39 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methyl-2H-indazol-6-yl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]acetamide is sourced from PubChem (CID 91449110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).