C10H14N2O3 — CID 91449118
2-(4,5-dimethyl-3-oxo-1H-pyrazol-2-yl)ethyl prop-2-enoate (PubChem CID 91449118) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4,5-dimethyl-3-oxo-1H-pyrazol-2-yl)ethyl prop-2-enoate.
| Compound Name | 2-(4,5-dimethyl-3-oxo-1H-pyrazol-2-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91449118 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-(4,5-dimethyl-3-oxo-1H-pyrazol-2-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1[nH]c(C)c(C)c1=O |
| InChI | InChI=1S/C10H14N2O3/c1-4-9(13)15-6-5-12-10(14)7(2)8(3)11-12/h4,11H,1,5-6H2,2-3H3 |
| InChIKey | NEGVWEBYKFNFCZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|