About N-hydroxy-5,5-dimethylpiperazine-2-carboxamide
N-hydroxy-5,5-dimethylpiperazine-2-carboxamide (PubChem CID 91449760) has the molecular formula C7H15N3O2
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-hydroxy-5,5-dimethylpiperazine-2-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-5,5-dimethylpiperazine-2-carboxamide |
| PubChem CID | 91449760 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-hydroxy-5,5-dimethylpiperazine-2-carboxamide |
| SMILES | CC1(C)CNC(C(=O)NO)CN1 |
| InChI | InChI=1S/C7H15N3O2/c1-7(2)4-8-5(3-9-7)6(11)10-12/h5,8-9,12H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | NUKPJHDFCMQZBD-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-5,5-dimethylpiperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-5,5-dimethylpiperazine-2-carboxamide?
The IUPAC name of N-hydroxy-5,5-dimethylpiperazine-2-carboxamide (CID 91449760) is N-hydroxy-5,5-dimethylpiperazine-2-carboxamide.
What is the SMILES notation for N-hydroxy-5,5-dimethylpiperazine-2-carboxamide?
The canonical SMILES for N-hydroxy-5,5-dimethylpiperazine-2-carboxamide is CC1(C)CNC(C(=O)NO)CN1.
What is the InChIKey of N-hydroxy-5,5-dimethylpiperazine-2-carboxamide?
The InChIKey is NUKPJHDFCMQZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2/c1-7(2)4-8-5(3-9-7)6(11)10-12/h5,8-9,12H,3-4H2,1-2H3,(H,10,11).
What are the key properties of N-hydroxy-5,5-dimethylpiperazine-2-carboxamide?
N-hydroxy-5,5-dimethylpiperazine-2-carboxamide has a molecular weight of 173.22 g/mol, XLogP of -1.17, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-5,5-dimethylpiperazine-2-carboxamide is sourced from PubChem (CID 91449760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).