About ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate
ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate (PubChem CID 91449936) has the molecular formula C23H24BrFN2O4
and a molecular weight of 491.36 g/mol. Its IUPAC name is ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate |
| PubChem CID | 91449936 |
| Molecular Formula | C23H24BrFN2O4 |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate |
| SMILES | CC.COC(=O)c1ccncc1Br.COC(=O)c1ccncc1Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H12FNO2.C7H6BrNO2.C2H6/c1-18-14(17)13-5-6-16-9-11(13)7-10-3-2-4-12(15)8-10;1-11-7(10)5-2-3-9-4-6(5)8;1-2/h2-6,8-9H,7H2,1H3;2-4H,1H3;1-2H3 |
| InChIKey | FTKHKDHMJROGEK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate?
The IUPAC name of ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate (CID 91449936) is ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate.
What is the SMILES notation for ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate?
The canonical SMILES for ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate is CC.COC(=O)c1ccncc1Br.COC(=O)c1ccncc1Cc1cccc(F)c1.
What is the InChIKey of ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate?
The InChIKey is FTKHKDHMJROGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO2.C7H6BrNO2.C2H6/c1-18-14(17)13-5-6-16-9-11(13)7-10-3-2-4-12(15)8-10;1-11-7(10)5-2-3-9-4-6(5)8;1-2/h2-6,8-9H,7H2,1H3;2-4H,1H3;1-2H3.
What are the key properties of ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate?
ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate has a molecular weight of 491.36 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 3-bromopyridine-4-carboxylate;methyl 3-[(3-fluorophenyl)methyl]pyridine-4-carboxylate is sourced from PubChem (CID 91449936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).