About ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol
ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol (PubChem CID 91450046) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol.
Molecular Properties
| Compound Name | ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol |
| PubChem CID | 91450046 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol |
| SMILES | CC.C[C@H]1C=C[C@@H](CO)O1 |
| InChI | InChI=1S/C6H10O2.C2H6/c1-5-2-3-6(4-7)8-5;1-2/h2-3,5-7H,4H2,1H3;1-2H3/t5-,6-;/m0./s1 |
| InChIKey | JWAQYOMRIOVXTJ-GEMLJDPKSA-N |
| XLogP | 1.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol?
The IUPAC name of ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol (CID 91450046) is ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol.
What is the SMILES notation for ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol?
The canonical SMILES for ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol is CC.C[C@H]1C=C[C@@H](CO)O1.
What is the InChIKey of ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol?
The InChIKey is JWAQYOMRIOVXTJ-GEMLJDPKSA-N. The full InChI is InChI=1S/C6H10O2.C2H6/c1-5-2-3-6(4-7)8-5;1-2/h2-3,5-7H,4H2,1H3;1-2H3/t5-,6-;/m0./s1.
What are the key properties of ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol?
ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol has a molecular weight of 144.21 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2S,5S)-5-methyl-2,5-dihydrofuran-2-yl]methanol is sourced from PubChem (CID 91450046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).