About 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine
1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine (PubChem CID 91450126) has the molecular formula C7H20N8
and a molecular weight of 216.29 g/mol. Its IUPAC name is 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine.
Molecular Properties
| Compound Name | 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine |
| PubChem CID | 91450126 |
| Molecular Formula | C7H20N8 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine |
| SMILES | NCCC/N=C(\N)NN/C(N)=N/CCN |
| InChI | InChI=1S/C7H20N8/c8-2-1-4-12-6(10)14-15-7(11)13-5-3-9/h1-5,8-9H2,(H3,10,12,14)(H3,11,13,15) |
| InChIKey | ONLUWHZTXGOMEM-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine?
The IUPAC name of 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine (CID 91450126) is 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine.
What is the SMILES notation for 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine?
The canonical SMILES for 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine is NCCC/N=C(\N)NN/C(N)=N/CCN.
What is the InChIKey of 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine?
The InChIKey is ONLUWHZTXGOMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H20N8/c8-2-1-4-12-6(10)14-15-7(11)13-5-3-9/h1-5,8-9H2,(H3,10,12,14)(H3,11,13,15).
What are the key properties of 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine?
1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine has a molecular weight of 216.29 g/mol, XLogP of -2.98, 5 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[N'-(2-aminoethyl)carbamimidoyl]amino]-2-(3-aminopropyl)guanidine is sourced from PubChem (CID 91450126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).